C10H5Cl2FN4S — CID 169360695
methyl N-cyano-N'-(4,6-dichloro-2-cyano-3-fluorophenyl)carbamimidothioate (PubChem CID 169360695) has the molecular formula C10H5Cl2FN4S and a molecular weight of 303.15 g/mol. Its IUPAC name is methyl N-cyano-N'-(4,6-dichloro-2-cyano-3-fluorophenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(4,6-dichloro-2-cyano-3-fluorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 169360695 |
| Molecular Formula | C10H5Cl2FN4S |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | methyl N-cyano-N'-(4,6-dichloro-2-cyano-3-fluorophenyl)carbamimidothioate |
| SMILES | CS/C(=N\c1c(Cl)cc(Cl)c(F)c1C#N)NC#N |
| InChI | InChI=1S/C10H5Cl2FN4S/c1-18-10(16-4-15)17-9-5(3-14)8(13)6(11)2-7(9)12/h2H,1H3,(H,16,17) |
| InChIKey | SPDMDGRRCBZQET-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|