C10H5Br2F4N3S — CID 169361332
methyl N-cyano-N'-[2,4-dibromo-6-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate (PubChem CID 169361332) has the molecular formula C10H5Br2F4N3S and a molecular weight of 435.04 g/mol. Its IUPAC name is methyl N-cyano-N'-[2,4-dibromo-6-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2,4-dibromo-6-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169361332 |
| Molecular Formula | C10H5Br2F4N3S |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 432.85 |
| IUPAC Name | methyl N-cyano-N'-[2,4-dibromo-6-fluoro-3-(trifluoromethyl)phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1c(F)cc(Br)c(C(F)(F)F)c1Br)NC#N |
| InChI | InChI=1S/C10H5Br2F4N3S/c1-20-9(18-3-17)19-8-5(13)2-4(11)6(7(8)12)10(14,15)16/h2H,1H3,(H,18,19) |
| InChIKey | GFBOXBZYIUFOGU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|