C10H6BrF4N3O2S — CID 169364087
methyl N'-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate (PubChem CID 169364087) has the molecular formula C10H6BrF4N3O2S and a molecular weight of 388.14 g/mol. Its IUPAC name is methyl N'-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169364087 |
| Molecular Formula | C10H6BrF4N3O2S |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | methyl N'-[5-bromo-4-fluoro-2-hydroxy-3-(trifluoromethoxy)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(Br)c(F)c(OC(F)(F)F)c1O)NC#N |
| InChI | InChI=1S/C10H6BrF4N3O2S/c1-21-9(17-3-16)18-5-2-4(11)6(12)8(7(5)19)20-10(13,14)15/h2,19H,1H3,(H,17,18) |
| InChIKey | BAHXZNXHVPYPMH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|