C10H9Br2N3OS — CID 103414201
methyl N-cyano-N'-(2,4-dibromo-5-methoxyphenyl)carbamimidothioate (PubChem CID 103414201) has the molecular formula C10H9Br2N3OS and a molecular weight of 379.08 g/mol. Its IUPAC name is methyl N-cyano-N'-(2,4-dibromo-5-methoxyphenyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(2,4-dibromo-5-methoxyphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 103414201 |
| Molecular Formula | C10H9Br2N3OS |
| Molecular Weight | 379.08 g/mol |
| Exact Mass | 376.88 |
| IUPAC Name | methyl N-cyano-N'-(2,4-dibromo-5-methoxyphenyl)carbamimidothioate |
| SMILES | COc1cc(/N=C(/NC#N)SC)c(Br)cc1Br |
| InChI | InChI=1S/C10H9Br2N3OS/c1-16-9-4-8(6(11)3-7(9)12)15-10(17-2)14-5-13/h3-4H,1-2H3,(H,14,15) |
| InChIKey | ATYKSFDPTIBKMI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.08 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|