C11H12BrN3O2S2 — CID 169360510
methyl N'-(2-bromo-5-ethylsulfonylphenyl)-N-cyanocarbamimidothioate (PubChem CID 169360510) has the molecular formula C11H12BrN3O2S2 and a molecular weight of 362.27 g/mol. Its IUPAC name is methyl N'-(2-bromo-5-ethylsulfonylphenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(2-bromo-5-ethylsulfonylphenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169360510 |
| Molecular Formula | C11H12BrN3O2S2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | methyl N'-(2-bromo-5-ethylsulfonylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CCS(=O)(=O)c1ccc(Br)c(/N=C(/NC#N)SC)c1 |
| InChI | InChI=1S/C11H12BrN3O2S2/c1-3-19(16,17)8-4-5-9(12)10(6-8)15-11(18-2)14-7-13/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | AUMPKKRPDMAGGQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|