C14H17BrN4O2S — CID 169364084
tert-butyl N-[4-bromo-3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]carbamate (PubChem CID 169364084) has the molecular formula C14H17BrN4O2S and a molecular weight of 385.29 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 169364084 |
| Molecular Formula | C14H17BrN4O2S |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | tert-butyl N-[4-bromo-3-[[(cyanoamino)-methylsulfanylmethylidene]amino]phenyl]carbamate |
| SMILES | CS/C(=N\c1cc(NC(=O)OC(C)(C)C)ccc1Br)NC#N |
| InChI | InChI=1S/C14H17BrN4O2S/c1-14(2,3)21-13(20)18-9-5-6-10(15)11(7-9)19-12(22-4)17-8-16/h5-7H,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | HJVUEIGSWYFSQR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|