C16H14BrN5O2 — CID 168610066
tert-butyl N-[4-bromo-3-(1,2,2-tricyanoethenylamino)phenyl]carbamate (PubChem CID 168610066) has the molecular formula C16H14BrN5O2 and a molecular weight of 388.23 g/mol. Its IUPAC name is tert-butyl N-[4-bromo-3-(1,2,2-tricyanoethenylamino)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-bromo-3-(1,2,2-tricyanoethenylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 168610066 |
| Molecular Formula | C16H14BrN5O2 |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | tert-butyl N-[4-bromo-3-(1,2,2-tricyanoethenylamino)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Br)c(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C16H14BrN5O2/c1-16(2,3)24-15(23)21-11-4-5-12(17)13(6-11)22-14(9-20)10(7-18)8-19/h4-6,22H,1-3H3,(H,21,23) |
| InChIKey | BZNUTEFBTBMJBQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|