C17H14N6O3 — CID 168609915
tert-butyl N-[5-(1,2,2-tricyanoethenylamino)-1,2-benzoxazol-3-yl]carbamate (PubChem CID 168609915) has the molecular formula C17H14N6O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is tert-butyl N-[5-(1,2,2-tricyanoethenylamino)-1,2-benzoxazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[5-(1,2,2-tricyanoethenylamino)-1,2-benzoxazol-3-yl]carbamate |
|---|---|
| PubChem CID | 168609915 |
| Molecular Formula | C17H14N6O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | tert-butyl N-[5-(1,2,2-tricyanoethenylamino)-1,2-benzoxazol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1noc2ccc(NC(C#N)=C(C#N)C#N)cc12 |
| InChI | InChI=1S/C17H14N6O3/c1-17(2,3)25-16(24)22-15-12-6-11(4-5-14(12)26-23-15)21-13(9-20)10(7-18)8-19/h4-6,21H,1-3H3,(H,22,23,24) |
| InChIKey | KWTKBQQAMYESGW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|