About methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate
methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate (PubChem CID 168609857) has the molecular formula C14H8N6O2
and a molecular weight of 292.26 g/mol. Its IUPAC name is methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate |
| PubChem CID | 168609857 |
| Molecular Formula | C14H8N6O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c2ccc(NC(C#N)=C(C#N)C#N)cc12 |
| InChI | InChI=1S/C14H8N6O2/c1-22-14(21)13-10-4-9(2-3-11(10)19-20-13)18-12(7-17)8(5-15)6-16/h2-4,18H,1H3,(H,19,20) |
| InChIKey | KBNXOQIODBADOC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate?
The IUPAC name of methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate (CID 168609857) is methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate.
What is the SMILES notation for methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate?
The canonical SMILES for methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate is COC(=O)c1n[nH]c2ccc(NC(C#N)=C(C#N)C#N)cc12.
What is the InChIKey of methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate?
The InChIKey is KBNXOQIODBADOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N6O2/c1-22-14(21)13-10-4-9(2-3-11(10)19-20-13)18-12(7-17)8(5-15)6-16/h2-4,18H,1H3,(H,19,20).
What are the key properties of methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate?
methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate has a molecular weight of 292.26 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,2,2-tricyanoethenylamino)-1H-indazole-3-carboxylate is sourced from PubChem (CID 168609857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).