C22H16FN3O3 — CID 22479901
methyl 4-[[3-(4-fluorophenyl)-1H-indazol-5-yl]carbamoyl]benzoate (PubChem CID 22479901) has the molecular formula C22H16FN3O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is methyl 4-[[3-(4-fluorophenyl)-1H-indazol-5-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[3-(4-fluorophenyl)-1H-indazol-5-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 22479901 |
| Molecular Formula | C22H16FN3O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | methyl 4-[[3-(4-fluorophenyl)-1H-indazol-5-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc3[nH]nc(-c4ccc(F)cc4)c3c2)cc1 |
| InChI | InChI=1S/C22H16FN3O3/c1-29-22(28)15-4-2-14(3-5-15)21(27)24-17-10-11-19-18(12-17)20(26-25-19)13-6-8-16(23)9-7-13/h2-12H,1H3,(H,24,27)(H,25,26) |
| InChIKey | PFPKMNBCOSJBCC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |