C17H12N4O3 — CID 35372978
methyl 5-[(4-cyanobenzoyl)amino]-1H-indazole-3-carboxylate (PubChem CID 35372978) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is methyl 5-[(4-cyanobenzoyl)amino]-1H-indazole-3-carboxylate.
| Compound Name | methyl 5-[(4-cyanobenzoyl)amino]-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 35372978 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | methyl 5-[(4-cyanobenzoyl)amino]-1H-indazole-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c2ccc(NC(=O)c3ccc(C#N)cc3)cc12 |
| InChI | InChI=1S/C17H12N4O3/c1-24-17(23)15-13-8-12(6-7-14(13)20-21-15)19-16(22)11-4-2-10(9-18)3-5-11/h2-8H,1H3,(H,19,22)(H,20,21) |
| InChIKey | WXXPKEJGKQCSMN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |