C15H14N3OP — CID 143488725
N-[3-(4-phosphanylphenyl)-1H-indazol-5-yl]acetamide (PubChem CID 143488725) has the molecular formula C15H14N3OP and a molecular weight of 283.27 g/mol. Its IUPAC name is N-[3-(4-phosphanylphenyl)-1H-indazol-5-yl]acetamide.
| Compound Name | N-[3-(4-phosphanylphenyl)-1H-indazol-5-yl]acetamide |
|---|---|
| PubChem CID | 143488725 |
| Molecular Formula | C15H14N3OP |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | N-[3-(4-phosphanylphenyl)-1H-indazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2[nH]nc(-c3ccc(P)cc3)c2c1 |
| InChI | InChI=1S/C15H14N3OP/c1-9(19)16-11-4-7-14-13(8-11)15(18-17-14)10-2-5-12(20)6-3-10/h2-8H,20H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | HXEMVPAOHZBPSC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|