C28H31N5O2 — CID 86710981
1-(2,6-diethylphenyl)-3-[3-(4-morpholin-4-ylphenyl)-1H-indazol-5-yl]urea (PubChem CID 86710981) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[3-(4-morpholin-4-ylphenyl)-1H-indazol-5-yl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[3-(4-morpholin-4-ylphenyl)-1H-indazol-5-yl]urea |
|---|---|
| PubChem CID | 86710981 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[3-(4-morpholin-4-ylphenyl)-1H-indazol-5-yl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)Nc1ccc2[nH]nc(-c3ccc(N4CCOCC4)cc3)c2c1 |
| InChI | InChI=1S/C28H31N5O2/c1-3-19-6-5-7-20(4-2)26(19)30-28(34)29-22-10-13-25-24(18-22)27(32-31-25)21-8-11-23(12-9-21)33-14-16-35-17-15-33/h5-13,18H,3-4,14-17H2,1-2H3,(H,31,32)(H2,29,30,34) |
| InChIKey | OICRUCLHDMHUFV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |