C18H20N4O — CID 123590663
4-[4-(5-ethyl-1H-indazol-3-yl)-2-pyridinyl]morpholine (PubChem CID 123590663) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 4-[4-(5-ethyl-1H-indazol-3-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-[4-(5-ethyl-1H-indazol-3-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 123590663 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-[4-(5-ethyl-1H-indazol-3-yl)-2-pyridinyl]morpholine |
| SMILES | CCc1ccc2[nH]nc(-c3ccnc(N4CCOCC4)c3)c2c1 |
| InChI | InChI=1S/C18H20N4O/c1-2-13-3-4-16-15(11-13)18(21-20-16)14-5-6-19-17(12-14)22-7-9-23-10-8-22/h3-6,11-12H,2,7-10H2,1H3,(H,20,21) |
| InChIKey | OSIMEUAEGWSVPT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |