C22H20FN5O2 — CID 90400745
4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1H-indazol-3-yl]-2-pyridinyl]morpholine (PubChem CID 90400745) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1H-indazol-3-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1H-indazol-3-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 90400745 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 4-[4-[5-(2-fluoro-4-methoxy-3-pyridinyl)-1H-indazol-3-yl]-2-pyridinyl]morpholine |
| SMILES | COc1ccnc(F)c1-c1ccc2[nH]nc(-c3ccnc(N4CCOCC4)c3)c2c1 |
| InChI | InChI=1S/C22H20FN5O2/c1-29-18-5-7-25-22(23)20(18)14-2-3-17-16(12-14)21(27-26-17)15-4-6-24-19(13-15)28-8-10-30-11-9-28/h2-7,12-13H,8-11H2,1H3,(H,26,27) |
| InChIKey | GGEHOODAQAMUQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|