C22H21FN6OS — CID 144697519
5-(2-fluoro-4-methoxy-3-pyridinyl)-3-[2-(4-sulfanylpiperazin-1-yl)-4-pyridinyl]-1H-indazole (PubChem CID 144697519) has the molecular formula C22H21FN6OS and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-(2-fluoro-4-methoxy-3-pyridinyl)-3-[2-(4-sulfanylpiperazin-1-yl)-4-pyridinyl]-1H-indazole.
| Compound Name | 5-(2-fluoro-4-methoxy-3-pyridinyl)-3-[2-(4-sulfanylpiperazin-1-yl)-4-pyridinyl]-1H-indazole |
|---|---|
| PubChem CID | 144697519 |
| Molecular Formula | C22H21FN6OS |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-(2-fluoro-4-methoxy-3-pyridinyl)-3-[2-(4-sulfanylpiperazin-1-yl)-4-pyridinyl]-1H-indazole |
| SMILES | COc1ccnc(F)c1-c1ccc2[nH]nc(-c3ccnc(N4CCN(S)CC4)c3)c2c1 |
| InChI | InChI=1S/C22H21FN6OS/c1-30-18-5-7-25-22(23)20(18)14-2-3-17-16(12-14)21(27-26-17)15-4-6-24-19(13-15)28-8-10-29(31)11-9-28/h2-7,12-13,31H,8-11H2,1H3,(H,26,27) |
| InChIKey | MVUIEISCGAUKIR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|