C20H15Cl2N5O3S — CID 53476641
1-(2,6-dichlorophenyl)-3-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]urea (PubChem CID 53476641) has the molecular formula C20H15Cl2N5O3S and a molecular weight of 476.35 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]urea |
|---|---|
| PubChem CID | 53476641 |
| Molecular Formula | C20H15Cl2N5O3S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]urea |
| SMILES | NS(=O)(=O)c1cccc(-c2n[nH]c3ccc(NC(=O)Nc4c(Cl)cccc4Cl)cc23)c1 |
| InChI | InChI=1S/C20H15Cl2N5O3S/c21-15-5-2-6-16(22)19(15)25-20(28)24-12-7-8-17-14(10-12)18(27-26-17)11-3-1-4-13(9-11)31(23,29)30/h1-10H,(H,26,27)(H2,23,29,30)(H2,24,25,28) |
| InChIKey | OESADEJASQKSMP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |