C26H27N5O3S — CID 67455298
1-benzyl-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]piperidine-4-carboxamide (PubChem CID 67455298) has the molecular formula C26H27N5O3S and a molecular weight of 489.60 g/mol. Its IUPAC name is 1-benzyl-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 67455298 |
| Molecular Formula | C26H27N5O3S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-benzyl-N-[3-(3-sulfamoylphenyl)-1H-indazol-5-yl]piperidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(-c2n[nH]c3ccc(NC(=O)C4CCN(Cc5ccccc5)CC4)cc23)c1 |
| InChI | InChI=1S/C26H27N5O3S/c27-35(33,34)22-8-4-7-20(15-22)25-23-16-21(9-10-24(23)29-30-25)28-26(32)19-11-13-31(14-12-19)17-18-5-2-1-3-6-18/h1-10,15-16,19H,11-14,17H2,(H,28,32)(H,29,30)(H2,27,33,34) |
| InChIKey | SGESKSDFEBHKGC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |