C26H29N3O3S — CID 45019498
1-benzyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperidine-4-carboxamide (PubChem CID 45019498) has the molecular formula C26H29N3O3S and a molecular weight of 463.60 g/mol. Its IUPAC name is 1-benzyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45019498 |
| Molecular Formula | C26H29N3O3S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 1-benzyl-N-[4-[(4-methylphenyl)sulfamoyl]phenyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)C3CCN(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O3S/c1-20-7-9-24(10-8-20)28-33(31,32)25-13-11-23(12-14-25)27-26(30)22-15-17-29(18-16-22)19-21-5-3-2-4-6-21/h2-14,22,28H,15-19H2,1H3,(H,27,30) |
| InChIKey | BSXKCBQLQHQUNF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |