C22H25N3O2 — CID 70048298
1-benzyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperidine-4-carboxamide (PubChem CID 70048298) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-benzyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 70048298 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-benzyl-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperidine-4-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)C3CCN(Cc4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C22H25N3O2/c26-21-9-6-18-14-19(7-8-20(18)24-21)23-22(27)17-10-12-25(13-11-17)15-16-4-2-1-3-5-16/h1-5,7-8,14,17H,6,9-13,15H2,(H,23,27)(H,24,26) |
| InChIKey | YRHRLEPWDRJQFR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |