C17H16N2O3 — CID 18571268
N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-phenoxyacetamide (PubChem CID 18571268) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-phenoxyacetamide.
| Compound Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 18571268 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H16N2O3/c20-16-9-6-12-10-13(7-8-15(12)19-16)18-17(21)11-22-14-4-2-1-3-5-14/h1-5,7-8,10H,6,9,11H2,(H,18,21)(H,19,20) |
| InChIKey | WHGPXXRDKSKTPB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |