C25H23N3O4 — CID 24676625
N-benzyl-2-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]benzamide (PubChem CID 24676625) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-benzyl-2-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]benzamide.
| Compound Name | N-benzyl-2-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24676625 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-benzyl-2-[[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]acetyl]amino]benzamide |
| SMILES | O=C1CCc2cc(OCC(=O)Nc3ccccc3C(=O)NCc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C25H23N3O4/c29-23-13-10-18-14-19(11-12-21(18)27-23)32-16-24(30)28-22-9-5-4-8-20(22)25(31)26-15-17-6-2-1-3-7-17/h1-9,11-12,14H,10,13,15-16H2,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | SELUHQCCAILDCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |