About 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea
1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea (PubChem CID 72849724) has the molecular formula C22H26N4O2
and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
Molecular Properties
| Compound Name | 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| PubChem CID | 72849724 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea |
| SMILES | CN(CC1CCN(Cc2ccccc2)C1)C(=O)Nc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C22H26N4O2/c1-25(13-17-9-10-26(15-17)14-16-5-3-2-4-6-16)22(28)23-19-7-8-20-18(11-19)12-21(27)24-20/h2-8,11,17H,9-10,12-15H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | UKGRGMSBZGBPAJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea?
The IUPAC name of 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea (CID 72849724) is 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea.
What is the SMILES notation for 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea?
The canonical SMILES for 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea is CN(CC1CCN(Cc2ccccc2)C1)C(=O)Nc1ccc2c(c1)CC(=O)N2.
What is the InChIKey of 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea?
The InChIKey is UKGRGMSBZGBPAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2/c1-25(13-17-9-10-26(15-17)14-16-5-3-2-4-6-16)22(28)23-19-7-8-20-18(11-19)12-21(27)24-20/h2-8,11,17H,9-10,12-15H2,1H3,(H,23,28)(H,24,27).
What are the key properties of 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea?
1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea has a molecular weight of 378.48 g/mol, XLogP of 3.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-benzylpyrrolidin-3-yl)methyl]-1-methyl-3-(2-oxo-1,3-dihydroindol-5-yl)urea is sourced from PubChem (CID 72849724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).