C22H35N3O — CID 119884980
N-[(1-benzylpyrrolidin-3-yl)methyl]-N-methyl-3-piperidin-4-ylbutanamide (PubChem CID 119884980) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is N-[(1-benzylpyrrolidin-3-yl)methyl]-N-methyl-3-piperidin-4-ylbutanamide.
| Compound Name | N-[(1-benzylpyrrolidin-3-yl)methyl]-N-methyl-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119884980 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | N-[(1-benzylpyrrolidin-3-yl)methyl]-N-methyl-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)N(C)CC1CCN(Cc2ccccc2)C1)C1CCNCC1 |
| InChI | InChI=1S/C22H35N3O/c1-18(21-8-11-23-12-9-21)14-22(26)24(2)15-20-10-13-25(17-20)16-19-6-4-3-5-7-19/h3-7,18,20-21,23H,8-17H2,1-2H3 |
| InChIKey | YMAXWXZVNYBWGI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |