C21H33ClN2O — CID 119752557
N-benzyl-N-(cyclobutylmethyl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119752557) has the molecular formula C21H33ClN2O and a molecular weight of 364.96 g/mol. Its IUPAC name is N-benzyl-N-(cyclobutylmethyl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-benzyl-N-(cyclobutylmethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119752557 |
| Molecular Formula | C21H33ClN2O |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-benzyl-N-(cyclobutylmethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(Cc1ccccc1)CC1CCC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C21H32N2O.ClH/c1-17(20-10-12-22-13-11-20)14-21(24)23(16-19-8-5-9-19)15-18-6-3-2-4-7-18;/h2-4,6-7,17,19-20,22H,5,8-16H2,1H3;1H |
| InChIKey | BFGXJPDTFVTHEG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |