C22H34N2O — CID 119799552
N-(cyclobutylmethyl)-N-(1-phenylethyl)-3-piperidin-4-ylbutanamide (PubChem CID 119799552) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N-(1-phenylethyl)-3-piperidin-4-ylbutanamide.
| Compound Name | N-(cyclobutylmethyl)-N-(1-phenylethyl)-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119799552 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | N-(cyclobutylmethyl)-N-(1-phenylethyl)-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)N(CC1CCC1)C(C)c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C22H34N2O/c1-17(20-11-13-23-14-12-20)15-22(25)24(16-19-7-6-8-19)18(2)21-9-4-3-5-10-21/h3-5,9-10,17-20,23H,6-8,11-16H2,1-2H3 |
| InChIKey | WPHZUMDYNQFLMJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |