C20H26N2O3 — CID 95635301
N-(cyclobutylmethyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 95635301) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | N-(cyclobutylmethyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 95635301 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(cyclobutylmethyl)-3-(2,5-dioxopyrrolidin-1-yl)-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](c1ccccc1)N(CC1CCC1)C(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C20H26N2O3/c1-15(17-8-3-2-4-9-17)22(14-16-6-5-7-16)20(25)12-13-21-18(23)10-11-19(21)24/h2-4,8-9,15-16H,5-7,10-14H2,1H3/t15-/m0/s1 |
| InChIKey | KYZIVLHKCQERHR-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|