C25H34N2O — CID 10271032
N-[(1R)-1-phenylethyl]-N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]propanamide (PubChem CID 10271032) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]propanamide.
| Compound Name | N-[(1R)-1-phenylethyl]-N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 10271032 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-N-[[1-(2-phenylethyl)piperidin-3-yl]methyl]propanamide |
| SMILES | CCC(=O)N(CC1CCCN(CCc2ccccc2)C1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H34N2O/c1-3-25(28)27(21(2)24-14-8-5-9-15-24)20-23-13-10-17-26(19-23)18-16-22-11-6-4-7-12-22/h4-9,11-12,14-15,21,23H,3,10,13,16-20H2,1-2H3/t21-,23?/m1/s1 |
| InChIKey | UGPDZNDSJCXCLQ-FKHAVUOCSA-N |
| XLogP | 4.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |