C22H35ClN2O — CID 119771595
N-cyclopentyl-N-(2-phenylethyl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119771595) has the molecular formula C22H35ClN2O and a molecular weight of 378.99 g/mol. Its IUPAC name is N-cyclopentyl-N-(2-phenylethyl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-cyclopentyl-N-(2-phenylethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119771595 |
| Molecular Formula | C22H35ClN2O |
| Molecular Weight | 378.99 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-cyclopentyl-N-(2-phenylethyl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(CCc1ccccc1)C1CCCC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C22H34N2O.ClH/c1-18(20-11-14-23-15-12-20)17-22(25)24(21-9-5-6-10-21)16-13-19-7-3-2-4-8-19;/h2-4,7-8,18,20-21,23H,5-6,9-17H2,1H3;1H |
| InChIKey | HMDYLQBKIVMAAI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.99 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |