C20H30N2O — CID 99946333
N-cyclohexyl-N-(2-phenylethyl)-2-[(3S)-pyrrolidin-3-yl]acetamide (PubChem CID 99946333) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is N-cyclohexyl-N-(2-phenylethyl)-2-[(3S)-pyrrolidin-3-yl]acetamide.
| Compound Name | N-cyclohexyl-N-(2-phenylethyl)-2-[(3S)-pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 99946333 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | N-cyclohexyl-N-(2-phenylethyl)-2-[(3S)-pyrrolidin-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCNC1)N(CCc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H30N2O/c23-20(15-18-11-13-21-16-18)22(19-9-5-2-6-10-19)14-12-17-7-3-1-4-8-17/h1,3-4,7-8,18-19,21H,2,5-6,9-16H2/t18-/m0/s1 |
| InChIKey | HCQFWSPVCIENLP-SFHVURJKSA-N |
| XLogP | 3.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |