C16H20F3NO — CID 563302
N-cyclohexyl-2,2,2-trifluoro-N-(2-phenylethyl)acetamide (PubChem CID 563302) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is N-cyclohexyl-2,2,2-trifluoro-N-(2-phenylethyl)acetamide.
| Compound Name | N-cyclohexyl-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 563302 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-cyclohexyl-2,2,2-trifluoro-N-(2-phenylethyl)acetamide |
| SMILES | O=C(N(CCc1ccccc1)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO/c17-16(18,19)15(21)20(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2 |
| InChIKey | BKKSAMKWHMPTKM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |