C19H28N2O — CID 119746206
N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-3-piperidin-4-ylbutanamide (PubChem CID 119746206) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-3-piperidin-4-ylbutanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119746206 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-N-methyl-3-piperidin-4-ylbutanamide |
| SMILES | CC(CC(=O)N(C)C1Cc2ccccc2C1)C1CCNCC1 |
| InChI | InChI=1S/C19H28N2O/c1-14(15-7-9-20-10-8-15)11-19(22)21(2)18-12-16-5-3-4-6-17(16)13-18/h3-6,14-15,18,20H,7-13H2,1-2H3 |
| InChIKey | GKNNHFVBQOZTIU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |