C21H14Cl2N4O2 — CID 58863539
3-[3-[(3,5-dichlorobenzoyl)amino]phenyl]-1H-indazole-5-carboxamide (PubChem CID 58863539) has the molecular formula C21H14Cl2N4O2 and a molecular weight of 425.28 g/mol. Its IUPAC name is 3-[3-[(3,5-dichlorobenzoyl)amino]phenyl]-1H-indazole-5-carboxamide.
| Compound Name | 3-[3-[(3,5-dichlorobenzoyl)amino]phenyl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 58863539 |
| Molecular Formula | C21H14Cl2N4O2 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 3-[3-[(3,5-dichlorobenzoyl)amino]phenyl]-1H-indazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2[nH]nc(-c3cccc(NC(=O)c4cc(Cl)cc(Cl)c4)c3)c2c1 |
| InChI | InChI=1S/C21H14Cl2N4O2/c22-14-6-13(7-15(23)10-14)21(29)25-16-3-1-2-11(8-16)19-17-9-12(20(24)28)4-5-18(17)26-27-19/h1-10H,(H2,24,28)(H,25,29)(H,26,27) |
| InChIKey | AWAMYCNZWGLYJN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |