C14H7N5O3 — CID 168608931
methyl 5-(1,2,2-tricyanoethenylamino)-1,3-benzoxazole-2-carboxylate (PubChem CID 168608931) has the molecular formula C14H7N5O3 and a molecular weight of 293.24 g/mol. Its IUPAC name is methyl 5-(1,2,2-tricyanoethenylamino)-1,3-benzoxazole-2-carboxylate.
| Compound Name | methyl 5-(1,2,2-tricyanoethenylamino)-1,3-benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 168608931 |
| Molecular Formula | C14H7N5O3 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl 5-(1,2,2-tricyanoethenylamino)-1,3-benzoxazole-2-carboxylate |
| SMILES | COC(=O)c1nc2cc(NC(C#N)=C(C#N)C#N)ccc2o1 |
| InChI | InChI=1S/C14H7N5O3/c1-21-14(20)13-19-10-4-9(2-3-12(10)22-13)18-11(7-17)8(5-15)6-16/h2-4,18H,1H3 |
| InChIKey | FWYACCYFBBUXSS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 135.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|