C19H10ClN5O2 — CID 168609432
2-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609432) has the molecular formula C19H10ClN5O2 and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609432 |
| Molecular Formula | C19H10ClN5O2 |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[[2-(3-chloro-4-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | COc1ccc(-c2nc3cc(NC(C#N)=C(C#N)C#N)ccc3o2)cc1Cl |
| InChI | InChI=1S/C19H10ClN5O2/c1-26-17-4-2-11(6-14(17)20)19-25-15-7-13(3-5-18(15)27-19)24-16(10-23)12(8-21)9-22/h2-7,24H,1H3 |
| InChIKey | BWLWZJLXFQJHEX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|