C22H16Cl2N2O4 — CID 2279423
2,3-dichloro-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 2279423) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 443.29 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 2,3-dichloro-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 2279423 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2,3-dichloro-N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)c4cccc(Cl)c4Cl)ccc3o2)cc1OC |
| InChI | InChI=1S/C22H16Cl2N2O4/c1-28-18-8-6-12(10-19(18)29-2)22-26-16-11-13(7-9-17(16)30-22)25-21(27)14-4-3-5-15(23)20(14)24/h3-11H,1-2H3,(H,25,27) |
| InChIKey | OBYMBWXDVRXPCS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |