C19H14N4O3 — CID 168543199
2-[[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile (PubChem CID 168543199) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 2-[[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile.
| Compound Name | 2-[[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543199 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-[[[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile |
| SMILES | COc1ccc(-c2nc3cc(NC=C(C#N)C#N)ccc3o2)cc1OC |
| InChI | InChI=1S/C19H14N4O3/c1-24-17-5-3-13(7-18(17)25-2)19-23-15-8-14(4-6-16(15)26-19)22-11-12(9-20)10-21/h3-8,11,22H,1-2H3 |
| InChIKey | FIMGUGPHYYMKQB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|