C18H12N4O2 — CID 168544300
2-[[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile (PubChem CID 168544300) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-[[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile.
| Compound Name | 2-[[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168544300 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-[[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]amino]methylidene]propanedinitrile |
| SMILES | COc1cccc(-c2nc3cc(NC=C(C#N)C#N)ccc3o2)c1 |
| InChI | InChI=1S/C18H12N4O2/c1-23-15-4-2-3-13(7-15)18-22-16-8-14(5-6-17(16)24-18)21-11-12(9-19)10-20/h2-8,11,21H,1H3 |
| InChIKey | VLTJIBNEAILNIA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|