C15H12N2O3 — CID 168652805
N-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]formamide (PubChem CID 168652805) has the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]formamide.
| Compound Name | N-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]formamide |
|---|---|
| PubChem CID | 168652805 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]formamide |
| SMILES | COc1cccc(-c2nc3ccc(NC=O)cc3o2)c1 |
| InChI | InChI=1S/C15H12N2O3/c1-19-12-4-2-3-10(7-12)15-17-13-6-5-11(16-9-18)8-14(13)20-15/h2-9H,1H3,(H,16,18) |
| InChIKey | VAJZVTUMSWQHSB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|