C16H16N6O2 — CID 168604323
1-(diaminomethylidene)-2-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]guanidine (PubChem CID 168604323) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]guanidine |
|---|---|
| PubChem CID | 168604323 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3-methoxyphenyl)-1,3-benzoxazol-6-yl]guanidine |
| SMILES | COc1cccc(-c2nc3ccc(/N=C(\N)N=C(N)N)cc3o2)c1 |
| InChI | InChI=1S/C16H16N6O2/c1-23-11-4-2-3-9(7-11)14-21-12-6-5-10(8-13(12)24-14)20-16(19)22-15(17)18/h2-8H,1H3,(H6,17,18,19,20,22) |
| InChIKey | BWOMOCIXXGJCKE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 138.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|