C17H18N6O3 — CID 168603578
1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]guanidine (PubChem CID 168603578) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]guanidine |
|---|---|
| PubChem CID | 168603578 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]guanidine |
| SMILES | COc1ccc(-c2nc3cc(/N=C(\N)N=C(N)N)ccc3o2)cc1OC |
| InChI | InChI=1S/C17H18N6O3/c1-24-13-5-3-9(7-14(13)25-2)15-22-11-8-10(4-6-12(11)26-15)21-17(20)23-16(18)19/h3-8H,1-2H3,(H6,18,19,20,21,23) |
| InChIKey | MSZKJZATXNXVRW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 147.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|