C15H11F2N3O — CID 68546888
N'-[2-(3,4-difluorophenyl)-1,3-benzoxazol-5-yl]ethanimidamide (PubChem CID 68546888) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is N'-[2-(3,4-difluorophenyl)-1,3-benzoxazol-5-yl]ethanimidamide.
| Compound Name | N'-[2-(3,4-difluorophenyl)-1,3-benzoxazol-5-yl]ethanimidamide |
|---|---|
| PubChem CID | 68546888 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N'-[2-(3,4-difluorophenyl)-1,3-benzoxazol-5-yl]ethanimidamide |
| SMILES | C/C(N)=N\c1ccc2oc(-c3ccc(F)c(F)c3)nc2c1 |
| InChI | InChI=1S/C15H11F2N3O/c1-8(18)19-10-3-5-14-13(7-10)20-15(21-14)9-2-4-11(16)12(17)6-9/h2-7H,1H3,(H2,18,19) |
| InChIKey | JFCKBVYRXQDVPV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|