C21H16ClN3O — CID 169366935
2-chloro-N'-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]ethanimidamide (PubChem CID 169366935) has the molecular formula C21H16ClN3O and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-chloro-N'-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]ethanimidamide.
| Compound Name | 2-chloro-N'-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]ethanimidamide |
|---|---|
| PubChem CID | 169366935 |
| Molecular Formula | C21H16ClN3O |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-chloro-N'-[2-(4-phenylphenyl)-1,3-benzoxazol-5-yl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc2oc(-c3ccc(-c4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C21H16ClN3O/c22-13-20(23)24-17-10-11-19-18(12-17)25-21(26-19)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12H,13H2,(H2,23,24) |
| InChIKey | KMEYOHYYCKIQCZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|