C14H7F2NO3 — CID 59626001
2-(3,4-difluorophenyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 59626001) has the molecular formula C14H7F2NO3 and a molecular weight of 275.21 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3,4-difluorophenyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 59626001 |
| Molecular Formula | C14H7F2NO3 |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(-c3ccc(F)c(F)c3)oc2c1 |
| InChI | InChI=1S/C14H7F2NO3/c15-9-3-1-7(5-10(9)16)13-17-11-4-2-8(14(18)19)6-12(11)20-13/h1-6H,(H,18,19) |
| InChIKey | ZXBBUYUONQOIKC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |