C16H13NO3 — CID 81358248
2-(4-ethylphenyl)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 81358248) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(4-ethylphenyl)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 81358248 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-(4-ethylphenyl)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | CCc1ccc(-c2nc3ccc(C(=O)O)cc3o2)cc1 |
| InChI | InChI=1S/C16H13NO3/c1-2-10-3-5-11(6-4-10)15-17-13-8-7-12(16(18)19)9-14(13)20-15/h3-9H,2H2,1H3,(H,18,19) |
| InChIKey | HEGGNGMZVYBNIL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |