C17H17NO — CID 95910929
2-(4-ethylphenyl)-5,6-dimethyl-1,3-benzoxazole (PubChem CID 95910929) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-5,6-dimethyl-1,3-benzoxazole.
| Compound Name | 2-(4-ethylphenyl)-5,6-dimethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 95910929 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(4-ethylphenyl)-5,6-dimethyl-1,3-benzoxazole |
| SMILES | CCc1ccc(-c2nc3cc(C)c(C)cc3o2)cc1 |
| InChI | InChI=1S/C17H17NO/c1-4-13-5-7-14(8-6-13)17-18-15-9-11(2)12(3)10-16(15)19-17/h5-10H,4H2,1-3H3 |
| InChIKey | PHLQMRBVCYEIRT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |