C15H15N2O+ — CID 7339766
[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methylazanium (PubChem CID 7339766) has the molecular formula C15H15N2O+ and a molecular weight of 239.30 g/mol. Its IUPAC name is [4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methylazanium.
| Compound Name | [4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methylazanium |
|---|---|
| PubChem CID | 7339766 |
| Molecular Formula | C15H15N2O+ |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | [4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]methylazanium |
| SMILES | Cc1ccc2nc(-c3ccc(C[NH3+])cc3)oc2c1 |
| InChI | InChI=1S/C15H14N2O/c1-10-2-7-13-14(8-10)18-15(17-13)12-5-3-11(9-16)4-6-12/h2-8H,9,16H2,1H3/p+1 |
| InChIKey | VHBQFBZSMNLDCO-UHFFFAOYSA-O |
| XLogP | 2.55 |
| TPSA | 53.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |