C48H33N3O3 — CID 22960109
2-[4-[3,5-bis[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-5-methyl-1,3-benzoxazole (PubChem CID 22960109) has the molecular formula C48H33N3O3 and a molecular weight of 699.81 g/mol. Its IUPAC name is 2-[4-[3,5-bis[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[4-[3,5-bis[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 22960109 |
| Molecular Formula | C48H33N3O3 |
| Molecular Weight | 699.81 g/mol |
| Exact Mass | 699.25 |
| IUPAC Name | 2-[4-[3,5-bis[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]phenyl]phenyl]-5-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(-c3ccc(-c4cc(-c5ccc(-c6nc7cc(C)ccc7o6)cc5)cc(-c5ccc(-c6nc7cc(C)ccc7o6)cc5)c4)cc3)nc2c1 |
| InChI | InChI=1S/C48H33N3O3/c1-28-4-19-43-40(22-28)49-46(52-43)34-13-7-31(8-14-34)37-25-38(32-9-15-35(16-10-32)47-50-41-23-29(2)5-20-44(41)53-47)27-39(26-37)33-11-17-36(18-12-33)48-51-42-24-30(3)6-21-45(42)54-48/h4-27H,1-3H3 |
| InChIKey | MTNULEXKIXJUMP-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 78.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.81 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |