C23H20N2O — CID 25211761
N-methyl-4-[(E)-2-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]aniline (PubChem CID 25211761) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is N-methyl-4-[(E)-2-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]aniline.
| Compound Name | N-methyl-4-[(E)-2-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 25211761 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-methyl-4-[(E)-2-[4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]ethenyl]aniline |
| SMILES | CNc1ccc(/C=C/c2ccc(-c3nc4cc(C)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O/c1-16-3-14-22-21(15-16)25-23(26-22)19-10-6-17(7-11-19)4-5-18-8-12-20(24-2)13-9-18/h3-15,24H,1-2H3/b5-4+ |
| InChIKey | IKMSRKDLAZISGC-SNAWJCMRSA-N |
| XLogP | 6.02 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|