C23H19ClN2O — CID 25211870
4-[(E)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 25211870) has the molecular formula C23H19ClN2O and a molecular weight of 374.87 g/mol. Its IUPAC name is 4-[(E)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 25211870 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[(E)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(-c3nc4cc(Cl)ccc4o3)cc2)cc1 |
| InChI | InChI=1S/C23H19ClN2O/c1-26(2)20-12-7-17(8-13-20)4-3-16-5-9-18(10-6-16)23-25-21-15-19(24)11-14-22(21)27-23/h3-15H,1-2H3/b4-3+ |
| InChIKey | YMPIBBBOCFUIAC-ONEGZZNKSA-N |
| XLogP | 6.38 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|